Online Database of Chemicals from Around the World
|
CAS#: 5292-51-3 Product: Dimethyl 2,5-Difluoroterephthalate No suppilers available for the product. |
| Name | Dimethyl 2,5-Difluoroterephthalate |
|---|---|
| Synonyms | 2,5-Difluorobenzene-1,4-Dicarboxylic Acid Dimethyl Ester; Dimethyl 2,5-Difluoroterephthalate |
| Molecular Structure |  |
| Molecular Formula | C10H8F2O4 |
| Molecular Weight | 230.17 |
| CAS Registry Number | 5292-51-3 |
| EINECS | 226-136-2 |
| SMILES | C1=C(C(=CC(=C1F)C(=O)OC)F)C(=O)OC |
| InChI | 1S/C10H8F2O4/c1-15-9(13)5-3-8(12)6(4-7(5)11)10(14)16-2/h3-4H,1-2H3 |
| InChIKey | YQOQOCUGIYCMRF-UHFFFAOYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.651°C at 760 mmHg (Cal.) |
| Flash point | 133.072°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 2,5-Difluoroterephthalate |