|
CAS#: 53044-18-1 Product: 2,6-Dichloro-N,N-Dimethylbenzamide No suppilers available for the product. |
| Name | 2,6-Dichloro-N,N-Dimethylbenzamide |
|---|---|
| Synonyms | 2,6-Dichloro-N,N-Dimethyl-Benzamide; Benzamide, 2,6-Dichloro-N,N-Dimethyl-; N,N-Dimethyl-2,6-Dichlorobenzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 |
| CAS Registry Number | 53044-18-1 |
| SMILES | C1=CC=C(C(=C1Cl)C(=O)N(C)C)Cl |
| InChI | 1S/C9H9Cl2NO/c1-12(2)9(13)8-6(10)4-3-5-7(8)11/h3-5H,1-2H3 |
| InChIKey | ATDVTQPRNVNPGF-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.749°C at 760 mmHg (Cal.) |
| Flash point | 162.904°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dichloro-N,N-Dimethylbenzamide |