|
CAS#: 531-05-5 Product: 2,4,6-Triphenyl-1,3,5-Trithiane No suppilers available for the product. |
| Name | 2,4,6-Triphenyl-1,3,5-Trithiane |
|---|---|
| Synonyms | Aids-018207; Aids018207; 1,3,5-Trithiane, 2,4,6-Triphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18S3 |
| Molecular Weight | 366.55 |
| CAS Registry Number | 531-05-5 |
| SMILES | C1=CC=C(C=C1)C2SC(SC(S2)C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C21H18S3/c1-4-10-16(11-5-1)19-22-20(17-12-6-2-7-13-17)24-21(23-19)18-14-8-3-9-15-18/h1-15,19-21H |
| InChIKey | HJHSNTOTXYILIV-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.731°C at 760 mmHg (Cal.) |
| Flash point | 292.835°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Triphenyl-1,3,5-Trithiane |