|
CAS#: 53126-05-9 Product: Phosphoric Acid, Pentyl Ester, Potassium Salt No suppilers available for the product. |
| Name | Phosphoric Acid, Pentyl Ester, Potassium Salt |
|---|---|
| Synonyms | Dipotassium Amyl Phosphate; Phosphoric Acid, Pentyl Ester, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C5H11K2O4P |
| Molecular Weight | 244.31 |
| CAS Registry Number | 53126-05-9 |
| EINECS | 258-377-4 |
| SMILES | C(O[P]([O-])([O-])=O)CCCC.[K+].[K+] |
| InChI | 1S/C5H13O4P.2K/c1-2-3-4-5-9-10(6,7)8;;/h2-5H2,1H3,(H2,6,7,8);;/q;2*+1/p-2 |
| InChIKey | SJKSBJJZBQDIKM-UHFFFAOYSA-L |
| Boiling point | 285.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 126.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphoric Acid, Pentyl Ester, Potassium Salt |