|
CAS#: 53207-51-5 Product: 2,3-Dihydro-7-Methoxy-1,3-Dimethylquinolin-4(1H)-One No suppilers available for the product. |
| Name | 2,3-Dihydro-7-Methoxy-1,3-Dimethylquinolin-4(1H)-One |
|---|---|
| Synonyms | 1,3-Dimethyl-7-Methoxy-1,2,3,4-Tetrahydro-4-Quinolinone; 4-Quinolinone, 1,2,3,4-Tetrahydro-1,3-Dimethyl-7-Methoxy-; 5-21-12-00243 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 |
| CAS Registry Number | 53207-51-5 |
| SMILES | C1=C(C=CC2=C1N(CC(C2=O)C)C)OC |
| InChI | 1S/C12H15NO2/c1-8-7-13(2)11-6-9(15-3)4-5-10(11)12(8)14/h4-6,8H,7H2,1-3H3 |
| InChIKey | RJNBGHNHTZUKQP-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.022°C at 760 mmHg (Cal.) |
| Flash point | 167.302°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-7-Methoxy-1,3-Dimethylquinolin-4(1H)-One |