|
CAS#: 53252-10-1 Product: Phenyl(2-Thienyl) Ketone Oxime No suppilers available for the product. |
| Name | Phenyl(2-Thienyl) Ketone Oxime |
|---|---|
| Synonyms | Phenyl-(2-Thienyl)Methanone Oxime; (Nz)-N-(Phenyl-Thiophen-2-Yl-Methylidene)Hydroxylamine; 2-Thienylphenone, Oxime |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.26 |
| CAS Registry Number | 53252-10-1 |
| SMILES | C1=C(SC=C1)\C(=N/O)C2=CC=CC=C2 |
| InChI | 1S/C11H9NOS/c13-12-11(10-7-4-8-14-10)9-5-2-1-3-6-9/h1-8,13H/b12-11- |
| InChIKey | JPDMVNYBIMAOES-QXMHVHEDSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.093°C at 760 mmHg (Cal.) |
| Flash point | 164.926°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl(2-Thienyl) Ketone Oxime |