|
CAS#: 53279-32-6 Product: 2,4-Dihydroxy-6-(1,2-Dioxopropyl)Benzoic Acid No suppilers available for the product. |
| Name | 2,4-Dihydroxy-6-(1,2-Dioxopropyl)Benzoic Acid |
|---|---|
| Synonyms | 2-(1,2-Dioxopropyl)-4,6-Dihydroxybenzoic Acid; 2,4-Dihydroxy-6-Pyruvoyl-Benzoic Acid; Ddpba |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8O6 |
| Molecular Weight | 224.17 |
| CAS Registry Number | 53279-32-6 |
| SMILES | C1=C(C(=C(C(C(=O)C)=O)C=C1O)C(=O)O)O |
| InChI | 1S/C10H8O6/c1-4(11)9(14)6-2-5(12)3-7(13)8(6)10(15)16/h2-3,12-13H,1H3,(H,15,16) |
| InChIKey | QBIABBDGHOTZMI-UHFFFAOYSA-N |
| Density | 1.557g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.257°C at 760 mmHg (Cal.) |
| Flash point | 254.734°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dihydroxy-6-(1,2-Dioxopropyl)Benzoic Acid |