|
CAS#: 53394-96-0 Product: 2,3-Dihydro-2-(1-Hydroxyethylidene)-1H-Inden-1-One No suppilers available for the product. |
| Name | 2,3-Dihydro-2-(1-Hydroxyethylidene)-1H-Inden-1-One |
|---|---|
| Synonyms | 1H-Inden-1-One, 2,3-Dihydro-2-(1-Hydroxyethylidene)-; 2,3-Dihydro-2-(1-Hydroxyethylidene)-1H-Inden-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 |
| CAS Registry Number | 53394-96-0 |
| SMILES | C2=C1CC(=C(O)C1=CC=C2)C(=O)C |
| InChI | 1S/C11H10O2/c1-7(12)10-6-8-4-2-3-5-9(8)11(10)13/h2-5,13H,6H2,1H3 |
| InChIKey | XLIRLJBQWGWIDF-UHFFFAOYSA-N |
| Density | 1.281g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.689°C at 760 mmHg (Cal.) |
| Flash point | 151.639°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-2-(1-Hydroxyethylidene)-1H-Inden-1-One |