|
CAS#: 53445-96-8 Product: 1-Carboxyglutamic Acid No suppilers available for the product. |
| Name | 1-Carboxyglutamic Acid |
|---|---|
| Synonyms | 1,1,3-Propanetricarboxylic Acid, 3-Amino-; 1-Carboxyglutamic Acid; Gamma-Carboxyglutamate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9NO6 |
| Molecular Weight | 191.14 |
| CAS Registry Number | 53445-96-8 |
| SMILES | C(C(C(O)=O)C(O)=O)C(C(O)=O)N |
| InChI | 1S/C6H9NO6/c7-3(6(12)13)1-2(4(8)9)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | UHBYWPGGCSDKFX-UHFFFAOYSA-N |
| Density | 1.649g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.956°C at 760 mmHg (Cal.) |
| Flash point | 206.573°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Carboxyglutamic Acid |