|
CAS#: 53498-76-3 Product: 4-[[2-[4-[Bis(2-chloroethyl)amino]phenyl]acetyl]amino]Benzoic acid No suppilers available for the product. |
| Name | 4-[[2-[4-[Bis(2-chloroethyl)amino]phenyl]acetyl]amino]Benzoic acid |
|---|---|
| Synonyms | 4-[[2-[4-[Bis(2-Chloroethyl)Amino]Phenyl]-1-Oxoethyl]Amino]Benzoic Acid; 4-[2-[4-[Bis(2-Chloroethyl)Amino]Phenyl]Ethanoylamino]Benzoic Acid; 4-(((4-(Bis(2-Chloroethyl)Amino)Phenyl)Acetyl)Amino)Benzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.28 |
| CAS Registry Number | 53498-76-3 |
| SMILES | C1=C(N(CCCl)CCCl)C=CC(=C1)CC(=O)NC2=CC=C(C=C2)C(=O)O |
| InChI | 1S/C19H20Cl2N2O3/c20-9-11-23(12-10-21)17-7-1-14(2-8-17)13-18(24)22-16-5-3-15(4-6-16)19(25)26/h1-8H,9-13H2,(H,22,24)(H,25,26) |
| InChIKey | WAFSPMOKDIXHAB-UHFFFAOYSA-N |
| Density | 1.365g/cm3 (Cal.) |
|---|---|
| Boiling point | 649.662°C at 760 mmHg (Cal.) |
| Flash point | 346.704°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[[2-[4-[Bis(2-chloroethyl)amino]phenyl]acetyl]amino]Benzoic acid |