|
CAS#: 5350-05-0 Product: 2-Bromobenzothiophene 1,1-dioxide No suppilers available for the product. |
| Name | 2-Bromobenzothiophene 1,1-dioxide |
|---|---|
| Synonyms | 2-Bromobenzothiophene 1,1-Dioxide; Nsc3901; Inchi=1/C8h5bro2s/C9-8-5-6-3-1-2-4-7(6)12(8,10)11/H1-5 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5BrO2S |
| Molecular Weight | 245.09 |
| CAS Registry Number | 5350-05-0 |
| SMILES | C1=CC=CC2=C1[S](=O)(=O)C(=C2)Br |
| InChI | 1S/C8H5BrO2S/c9-8-5-6-3-1-2-4-7(6)12(8,10)11/h1-5H |
| InChIKey | GSNSVTOQAJSJSG-UHFFFAOYSA-N |
| Density | 1.875g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.236°C at 760 mmHg (Cal.) |
| Flash point | 206.742°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromobenzothiophene 1,1-dioxide |