|
CAS#: 5350-45-8 Product: 3-Hydroxy-3-Methyl-3-(4-Nitrophenyl)Propanoic Acid No suppilers available for the product. |
| Name | 3-Hydroxy-3-Methyl-3-(4-Nitrophenyl)Propanoic Acid |
|---|---|
| Synonyms | 3-Hydroxy-3-(4-Nitrophenyl)Butyric Acid; 3-Hydroxy-3-Methyl-3-(4-Nitrophenyl)Propanoic Acid; Nsc28 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 |
| CAS Registry Number | 5350-45-8 |
| SMILES | C1=CC(=CC=C1C(C)(O)CC(=O)O)[N+]([O-])=O |
| InChI | 1S/C10H11NO5/c1-10(14,6-9(12)13)7-2-4-8(5-3-7)11(15)16/h2-5,14H,6H2,1H3,(H,12,13) |
| InChIKey | KJKUAEMIKPSAOU-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.838°C at 760 mmHg (Cal.) |
| Flash point | 189.572°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-3-Methyl-3-(4-Nitrophenyl)Propanoic Acid |