|
CAS#: 5359-04-6 Product: 1-[4-(1-Methylethenyl)Phenyl]-Ethanone No suppilers available for the product. |
| Name | 1-[4-(1-Methylethenyl)Phenyl]-Ethanone |
|---|---|
| Synonyms | 1-(4-Isopropenylphenyl)Ethanone; Ethanone, 1-(4-(1-Methylethenyl)Phenyl)-; 1-[4-(1-Methylethenyl)Phenyl]Ethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 |
| CAS Registry Number | 5359-04-6 |
| SMILES | C1=CC(=CC=C1C(C)=C)C(C)=O |
| InChI | 1S/C11H12O/c1-8(2)10-4-6-11(7-5-10)9(3)12/h4-7H,1H2,2-3H3 |
| InChIKey | WMVUYUVKNFDYAF-UHFFFAOYSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.443°C at 760 mmHg (Cal.) |
| Flash point | 108.771°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(1-Methylethenyl)Phenyl]-Ethanone |