| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 2,4-Diphenylbutanoate |
|---|---|
| Synonyms | 2,4-Di(Phenyl)Butanoic Acid Ethyl Ester; 2,4-Di(Phenyl)Butyric Acid Ethyl Ester; Nsc82226 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.35 |
| CAS Registry Number | 53608-81-4 |
| SMILES | C2=C(CCC(C(=O)OCC)C1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C18H20O2/c1-2-20-18(19)17(16-11-7-4-8-12-16)14-13-15-9-5-3-6-10-15/h3-12,17H,2,13-14H2,1H3 |
| InChIKey | SJMGLWKVOOIJRS-UHFFFAOYSA-N |
| Density | 1.06g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.283°C at 760 mmHg (Cal.) |
| Flash point | 136.198°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2,4-Diphenylbutanoate |