|
CAS#: 53663-00-6 Product: Dehydrobruceantarin No suppilers available for the product. |
| Name | Dehydrobruceantarin |
|---|---|
| Synonyms | Nsc238179 |
| Molecular Structure | ![]() |
| Molecular Formula | C28H28O11 |
| Molecular Weight | 540.52 |
| CAS Registry Number | 53663-00-6 |
| SMILES | C6=C(C(OC3C4C25C(C1(C(=C(C(=O)C(=C1)O)C)CC2OC3=O)C)C(O)C(O)C4(OC5)C(OC)=O)=O)C=CC=C6 |
| InChI | 1S/C28H28O11/c1-12-14-9-16-27-11-37-28(25(35)36-3,22(32)18(31)20(27)26(14,2)10-15(29)17(12)30)21(27)19(24(34)38-16)39-23(33)13-7-5-4-6-8-13/h4-8,10,16,18-22,29,31-32H,9,11H2,1-3H3 |
| InChIKey | XFGZLTBOPDPUJU-UHFFFAOYSA-N |
| Density | 1.549g/cm3 (Cal.) |
|---|---|
| Boiling point | 782.763°C at 760 mmHg (Cal.) |
| Flash point | 262.596°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dehydrobruceantarin |