|
CAS#: 53692-24-3 Product: 3,3'-Di-Tert-Butyl-1,1'-Biphenyl No suppilers available for the product. |
| Name | 3,3'-Di-Tert-Butyl-1,1'-Biphenyl |
|---|---|
| Synonyms | 3,3'-Di-Tert-Butylbiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 |
| CAS Registry Number | 53692-24-3 |
| SMILES | C1=C(C=C(C=C1)C(C)(C)C)C2=CC(=CC=C2)C(C)(C)C |
| InChI | 1S/C20H26/c1-19(2,3)17-11-7-9-15(13-17)16-10-8-12-18(14-16)20(4,5)6/h7-14H,1-6H3 |
| InChIKey | VBEKOHMKJMZVGZ-UHFFFAOYSA-N |
| Density | 0.925g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.134°C at 760 mmHg (Cal.) |
| Flash point | 189.247°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Di-Tert-Butyl-1,1'-Biphenyl |