|
CAS#: 5370-41-2 Product: Pridefine No suppilers available for the product. |
| Name | Pridefine |
|---|---|
| Synonyms | 3-[Di(Phenyl)Methylene]-1-Ethyl-Pyrrolidine; 3-[Di(Phenyl)Methylene]-1-Ethylpyrrolidine; 3-[Di(Phenyl)Methylidene]-1-Ethyl-Pyrrolidine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 |
| CAS Registry Number | 5370-41-2 |
| SMILES | C3=C(C(=C1CN(CC)CC1)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C19H21N/c1-2-20-14-13-18(15-20)19(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12H,2,13-15H2,1H3 |
| InChIKey | BJUHVJHOJBHLJS-UHFFFAOYSA-N |
| Density | 1.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.108°C at 760 mmHg (Cal.) |
| Flash point | 172.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pridefine |