|
CAS#: 53718-37-9 Product: 1,2,3,6,7,8-Hexahydro-1,1,3,3,6,6,8,8-Octamethyl-As-Indacen-4-Ol No suppilers available for the product. |
| Name | 1,2,3,6,7,8-Hexahydro-1,1,3,3,6,6,8,8-Octamethyl-As-Indacen-4-Ol |
|---|---|
| Synonyms | 1,2,3,6,7,8-Hexahydro-1,1,3,3,6,6,8,8-Octamethyl-As-Indacen-4-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 |
| CAS Registry Number | 53718-37-9 |
| EINECS | 258-725-5 |
| SMILES | C2=C3C(=C1C(CC(C1=C2O)(C)C)(C)C)C(CC3(C)C)(C)C |
| InChI | 1S/C20H30O/c1-17(2)10-18(3,4)14-12(17)9-13(21)15-16(14)20(7,8)11-19(15,5)6/h9,21H,10-11H2,1-8H3 |
| InChIKey | QZWNGYFKEJRJAG-UHFFFAOYSA-N |
| Density | 0.956g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.777°C at 760 mmHg (Cal.) |
| Flash point | 153.102°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,6,7,8-Hexahydro-1,1,3,3,6,6,8,8-Octamethyl-As-Indacen-4-Ol |