Online Database of Chemicals from Around the World
|
CAS#: 53725-56-7 Product: 1-(N,N-Diethylglycyl)-4-Phenyl-2,2,6,6-Tetramethylpiperidine No suppilers available for the product. |
| Name | 1-(N,N-Diethylglycyl)-4-Phenyl-2,2,6,6-Tetramethylpiperidine |
|---|---|
| Synonyms | N,N-Diethyl-2-(2,2,6,6-Tetramethyl-4-Phenyl-1-Piperidyl)Acetamide; N,N-Diethyl-2-(2,2,6,6-Tetramethyl-4-Phenyl-1-Piperidinyl)Acetamide; N,N-Diethyl-2-(2,2,6,6-Tetramethyl-4-Phenyl-Piperidin-1-Yl)Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.51 |
| CAS Registry Number | 53725-56-7 |
| SMILES | C2=C(C1CC(N(CC(N(CC)CC)=O)C(C1)(C)C)(C)C)C=CC=C2 |
| InChI | 1S/C21H34N2O/c1-7-22(8-2)19(24)16-23-20(3,4)14-18(15-21(23,5)6)17-12-10-9-11-13-17/h9-13,18H,7-8,14-16H2,1-6H3 |
| InChIKey | QUHVMGBYIAZJBH-UHFFFAOYSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.712°C at 760 mmHg (Cal.) |
| Flash point | 153.631°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(N,N-Diethylglycyl)-4-Phenyl-2,2,6,6-Tetramethylpiperidine |