|
CAS#: 537678-11-8 Product: 2-(4-Methylphenyl)-3-{[3-(Trifluoromethyl)Phenyl]Sulfonyl}-1,3-Thiazolidine No suppilers available for the product. |
| Name | 2-(4-Methylphenyl)-3-{[3-(Trifluoromethyl)Phenyl]Sulfonyl}-1,3-Thiazolidine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H16F3NO2S2 |
| Molecular Weight | 387.44 |
| CAS Registry Number | 537678-11-8 |
| SMILES | Cc1ccc(cc1)C2N(CCS2)S(=O)(=O)c3cccc(c3)C(F)(F)F |
| InChI | 1S/C17H16F3NO2S2/c1-12-5-7-13(8-6-12)16-21(9-10-24-16)25(22,23)15-4-2-3-14(11-15)17(18,19)20/h2-8,11,16H,9-10H2,1H3 |
| InChIKey | FUAJVMVVIUOPFL-UHFFFAOYSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.264°C at 760 mmHg (Cal.) |
| Flash point | 258.77°C (Cal.) |
| Refractive index | 1.582 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methylphenyl)-3-{[3-(Trifluoromethyl)Phenyl]Sulfonyl}-1,3-Thiazolidine |