|
CAS#: 53816-91-4 Product: 3,6-Dinitro-1,2-Benzenediol No suppilers available for the product. |
| Name | 3,6-Dinitro-1,2-Benzenediol |
|---|---|
| Synonyms | 3,6-Dinitropyrocatechol; 1,2-Benzenediol, 3,6-Dinitro-; 3,6-Dinitro-1,2-Benzenediol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4N2O6 |
| Molecular Weight | 200.11 |
| CAS Registry Number | 53816-91-4 |
| SMILES | C1=CC(=C(O)C(=C1[N+]([O-])=O)O)[N+]([O-])=O |
| InChI | 1S/C6H4N2O6/c9-5-3(7(11)12)1-2-4(6(5)10)8(13)14/h1-2,9-10H |
| InChIKey | WQVRLADNOSJVJV-UHFFFAOYSA-N |
| Density | 1.82g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.698°C at 760 mmHg (Cal.) |
| Flash point | 134.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6-Dinitro-1,2-Benzenediol |