|
CAS#: 5386-57-2 Product: 2,4-Dinitro-6-(2-Pentanyl)Phenyl Isopropyl Carbonate No suppilers available for the product. |
| Name | 2,4-Dinitro-6-(2-Pentanyl)Phenyl Isopropyl Carbonate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.33 |
| CAS Registry Number | 5386-57-2 |
| SMILES | O=C(Oc1c(cc(cc1C(C)CCC)[N+]([O-])=O)[N+]([O-])=O)OC(C)C |
| InChI | 1S/C15H20N2O7/c1-5-6-10(4)12-7-11(16(19)20)8-13(17(21)22)14(12)24-15(18)23-9(2)3/h7-10H,5-6H2,1-4H3 |
| InChIKey | QQHRSBLQLJPBPJ-UHFFFAOYSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.622°C at 760 mmHg (Cal.) |
| Flash point | 164.08°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dinitro-6-(2-Pentanyl)Phenyl Isopropyl Carbonate |