|
CAS#: 53892-20-9 Product: 1-Methyl-4-[Phenyl(Thien-2-Ylmethyl)Ammonio]Piperidinium Maleate No suppilers available for the product. |
| Name | 1-Methyl-4-[Phenyl(Thien-2-Ylmethyl)Ammonio]Piperidinium Maleate |
|---|---|
| Synonyms | But-2-Enedioic Acid; 1-Methyl-N-Phenyl-N-(2-Thienylmethyl)Piperidin-4-Amine; But-2-Enedioic Acid; 1-Methyl-N-Phenyl-N-(2-Thienylmethyl)-4-Piperidinamine; But-2-Enedioic Acid; (1-Methyl-4-Piperidyl)-Phenyl-(2-Thienylmethyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.51 |
| CAS Registry Number | 53892-20-9 |
| EINECS | 258-844-2 |
| SMILES | C3=C(N(C1CCN(CC1)C)CC2=CC=CS2)C=CC=C3.O=C(O)\C=C/C(=O)O |
| InChI | 1S/C17H22N2S.C4H4O4/c1-18-11-9-16(10-12-18)19(14-17-8-5-13-20-17)15-6-3-2-4-7-15;5-3(6)1-2-4(7)8/h2-8,13,16H,9-12,14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | OYCQNZCKQWGYBZ-BTJKTKAUSA-N |
| Boiling point | 413.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 204.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-4-[Phenyl(Thien-2-Ylmethyl)Ammonio]Piperidinium Maleate |