|
CAS#: 53915-72-3 Product: 2,7-Bis(1,1,3,3-Tetramethylbutyl)-10H-Phenothiazine No suppilers available for the product. |
| Name | 2,7-Bis(1,1,3,3-Tetramethylbutyl)-10H-Phenothiazine |
|---|---|
| Synonyms | 2,7-Bis(1,1,3,3-Tetramethylbutyl)-10H-Phenothiazine |
| Molecular Structure | ![]() |
| Molecular Formula | C28H41NS |
| Molecular Weight | 423.70 |
| CAS Registry Number | 53915-72-3 |
| EINECS | 258-861-5 |
| SMILES | C2=C1NC3=C(SC1=CC=C2C(CC(C)(C)C)(C)C)C=C(C(CC(C)(C)C)(C)C)C=C3 |
| InChI | 1S/C28H41NS/c1-25(2,3)17-27(7,8)19-12-14-23-22(15-19)29-21-13-11-20(16-24(21)30-23)28(9,10)18-26(4,5)6/h11-16,29H,17-18H2,1-10H3 |
| InChIKey | ZXHLKLXHFDXLCW-UHFFFAOYSA-N |
| Density | 0.992g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.404°C at 760 mmHg (Cal.) |
| Flash point | 263.088°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7-Bis(1,1,3,3-Tetramethylbutyl)-10H-Phenothiazine |