|
CAS#: 53924-42-8 Product: (alphar)-alpha-(Acetylamino)-alpha-(Diphenylmethyl)-1H-Indole-3-Propionic Acid No suppilers available for the product. |
| Name | (alphar)-alpha-(Acetylamino)-alpha-(Diphenylmethyl)-1H-Indole-3-Propionic Acid |
|---|---|
| Synonyms | (2S)-2-Acetamido-3-[2-[Di(Phenyl)Methyl]-1H-Indol-3-Yl]Propionic Acid; N-Acetyl-2-(Diphenylmethyl)Tryptophan; Tryptophan, N-Acetyl-2-(Diphenylmethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 |
| CAS Registry Number | 53924-42-8 |
| SMILES | [C@H](C(=O)O)(NC(=O)C)CC1=C([NH]C2=CC=CC=C12)C(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C26H24N2O3/c1-17(29)27-23(26(30)31)16-21-20-14-8-9-15-22(20)28-25(21)24(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15,23-24,28H,16H2,1H3,(H,27,29)(H,30,31)/t23-/m0/s1 |
| InChIKey | IGNNDGRYXMRYNE-QHCPKHFHSA-N |
| Density | 1.256g/cm3 (Cal.) |
|---|---|
| Boiling point | 684.891°C at 760 mmHg (Cal.) |
| Flash point | 368.009°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (alphar)-alpha-(Acetylamino)-alpha-(Diphenylmethyl)-1H-Indole-3-Propionic Acid |