|
CAS#: 5400-60-2 Product: 4-Fluoroantipyrine No suppilers available for the product. |
| Name | 4-Fluoroantipyrine |
|---|---|
| Synonyms | 2-(4-Fluorophenyl)-1,5-Dimethyl-Pyrazol-3-One; 2-(4-Fluorophenyl)-1,5-Dimethyl-3-Pyrazolone; Nsc 10364 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 |
| CAS Registry Number | 5400-60-2 |
| SMILES | C2=C(N1N(C(=CC1=O)C)C)C=CC(=C2)F |
| InChI | 1S/C11H11FN2O/c1-8-7-11(15)14(13(8)2)10-5-3-9(12)4-6-10/h3-7H,1-2H3 |
| InChIKey | DPSOQADTQNTSSG-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.931°C at 760 mmHg (Cal.) |
| Flash point | 132.775°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluoroantipyrine |