Online Database of Chemicals from Around the World
|
CAS#: 5400-77-1 Product: 2,6-Diiodo-3-Methyl-4-Nitro-Aniline No suppilers available for the product. |
| Name | 2,6-Diiodo-3-Methyl-4-Nitro-Aniline |
|---|---|
| Synonyms | 2,6-Diiodo-3-Methyl-4-Nitro-Aniline; (2,6-Diiodo-3-Methyl-4-Nitro-Phenyl)Amine; M-Toluidine, 2,6-Diiodo-4-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C7H6I2N2O2 |
| Molecular Weight | 403.95 |
| CAS Registry Number | 5400-77-1 |
| SMILES | C1=C(I)C(=C(C(=C1[N+](=O)[O-])C)I)N |
| InChI | 1S/C7H6I2N2O2/c1-3-5(11(12)13)2-4(8)7(10)6(3)9/h2H,10H2,1H3 |
| InChIKey | PVERXMYYYHZCHE-UHFFFAOYSA-N |
| Density | 2.463g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.629°C at 760 mmHg (Cal.) |
| Flash point | 210.608°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,6-Diiodo-3-Methyl-4-Nitro-Aniline |