|
CAS#: 5401-14-9 Product: Diphenyl (Isothiocyanato)Phosphate No suppilers available for the product. |
| Name | Diphenyl (Isothiocyanato)Phosphate |
|---|---|
| Synonyms | Diphenyl (Isothiocyanato)Phosphate; Diphenoxyphosphinyl Isothiocyanate; Diphenyl Phosphoroisothiocyanatidate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10NO3PS |
| Molecular Weight | 291.26 |
| CAS Registry Number | 5401-14-9 |
| EINECS | 226-447-3 |
| SMILES | S=C=N[P](OC1=CC=CC=C1)(OC2=CC=CC=C2)=O |
| InChI | 1S/C13H10NO3PS/c15-18(14-11-19,16-12-7-3-1-4-8-12)17-13-9-5-2-6-10-13/h1-10H |
| InChIKey | QYGWFFSAYBRMHH-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.541°C at 760 mmHg (Cal.) |
| Flash point | 183.945°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diphenyl (Isothiocyanato)Phosphate |