Online Database of Chemicals from Around the World
|
CAS#: 54060-31-0 Product: 1,3-Bis(3-Nitrophenoxy)Benzene No suppilers available for the product. |
| Name | 1,3-Bis(3-Nitrophenoxy)Benzene |
|---|---|
| Synonyms | Benzene, 1,3-Bis(3-Nitrophenoxy)- |
| Molecular Structure |  |
| Molecular Formula | C18H12N2O6 |
| Molecular Weight | 352.30 |
| CAS Registry Number | 54060-31-0 |
| EINECS | 258-945-1 |
| SMILES | C1=CC=C(C=C1[N+]([O-])=O)OC2=CC(=CC=C2)OC3=CC(=CC=C3)[N+]([O-])=O |
| InChI | 1S/C18H12N2O6/c21-19(22)13-4-1-6-15(10-13)25-17-8-3-9-18(12-17)26-16-7-2-5-14(11-16)20(23)24/h1-12H |
| InChIKey | NYKPGQHPZCGOFF-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.762°C at 760 mmHg (Cal.) |
| Flash point | 202.207°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(3-Nitrophenoxy)Benzene |