|
CAS#: 5410-37-7 Product: 3-Methylphenylarsonic Acid No suppilers available for the product. |
| Name | 3-Methylphenylarsonic Acid |
|---|---|
| Synonyms | Arsonic Acid, (3-Methylphenyl)- (9Ci); Brn 2829820; Arsonic Acid, (3-Methylphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9AsO3 |
| Molecular Weight | 216.07 |
| CAS Registry Number | 5410-37-7 |
| SMILES | C1=C(C=CC=C1[As](=O)(O)O)C |
| InChI | 1S/C7H9AsO3/c1-6-3-2-4-7(5-6)8(9,10)11/h2-5H,1H3,(H2,9,10,11) |
| InChIKey | JEMCDGFTCLWRHL-UHFFFAOYSA-N |
| Boiling point | 448.828°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 239.372°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylphenylarsonic Acid |