|
CAS#: 54164-90-8 Product: trans-4-Hydroxy-alpha,alpha,4-Trimethylcyclohex-2-Ene-1-Methanol No suppilers available for the product. |
| Name | trans-4-Hydroxy-alpha,alpha,4-Trimethylcyclohex-2-Ene-1-Methanol |
|---|---|
| Synonyms | (1S,4R)-4-(1-Hydroxy-1-Methyl-Ethyl)-1-Methyl-Cyclohex-2-En-1-Ol; (1S,4R)-4-(1-Hydroxy-1-Methylethyl)-1-Methyl-1-Cyclohex-2-Enol; (1S,4R)-4-(2-Hydroxypropan-2-Yl)-1-Methyl-Cyclohex-2-En-1-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 54164-90-8 |
| EINECS | 259-006-9 |
| SMILES | [C@H]1(CC[C@](C=C1)(C)O)C(C)(C)O |
| InChI | 1S/C10H18O2/c1-9(2,11)8-4-6-10(3,12)7-5-8/h4,6,8,11-12H,5,7H2,1-3H3/t8-,10+/m0/s1 |
| InChIKey | XWFVRMWMBYDDFY-WCBMZHEXSA-N |
| Density | 1.048g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.995°C at 760 mmHg (Cal.) |
| Flash point | 121.98°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-4-Hydroxy-alpha,alpha,4-Trimethylcyclohex-2-Ene-1-Methanol |