|
CAS#: 5418-37-1 Product: 4-[(4-Hydroxy-3-Methylphenyl)Imino]-2,5-Cyclohexadien-1-One No suppilers available for the product. |
| Name | 4-[(4-Hydroxy-3-Methylphenyl)Imino]-2,5-Cyclohexadien-1-One |
|---|---|
| Synonyms | NSC10445 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23 |
| CAS Registry Number | 5418-37-1 |
| SMILES | O=C/2/C=C\C(=N\c1ccc(O)c(c1)C)\C=C\2 |
| InChI | 1S/C13H11NO2/c1-9-8-11(4-7-13(9)16)14-10-2-5-12(15)6-3-10/h2-8,16H,1H3 |
| InChIKey | AHRBKLAMEDLRHI-UHFFFAOYSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.891°C at 760 mmHg (Cal.) |
| Flash point | 184.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Hydroxy-3-Methylphenyl)Imino]-2,5-Cyclohexadien-1-One |