|
CAS#: 54234-59-2 Product: (3,4-Dihydroxyphenyl)Acetyl Chloride No suppilers available for the product. |
| Name | (3,4-Dihydroxyphenyl)Acetyl Chloride |
|---|---|
| Synonyms | 2-(3,4-Dihydroxyphenyl)Ethanoyl Chloride; (3,4-Dihydroxyphenyl)Acetyl Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7ClO3 |
| Molecular Weight | 186.59 |
| CAS Registry Number | 54234-59-2 |
| EINECS | 259-036-2 |
| SMILES | C1=C(C=CC(=C1O)O)CC(Cl)=O |
| InChI | 1S/C8H7ClO3/c9-8(12)4-5-1-2-6(10)7(11)3-5/h1-3,10-11H,4H2 |
| InChIKey | BUEXVFFGVMTYSY-UHFFFAOYSA-N |
| Density | 1.462g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.492°C at 760 mmHg (Cal.) |
| Flash point | 171.82°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3,4-Dihydroxyphenyl)Acetyl Chloride |