|
CAS#: 5425-22-9 Product: [4-[(4,6-Diamino-1,3,5-Triazin-2-Yl)Amino]Phenyl]Arsonous Acid No suppilers available for the product. |
| Name | [4-[(4,6-Diamino-1,3,5-Triazin-2-Yl)Amino]Phenyl]Arsonous Acid |
|---|---|
| Synonyms | [4-[(4,6-Diamino-S-Triazin-2-Yl)Amino]Phenyl]Arsonous Acid; Antineoplastic-12729; Nsc12729 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11AsN6O2 |
| Molecular Weight | 310.15 |
| CAS Registry Number | 5425-22-9 |
| SMILES | C1=CC(=CC=C1NC2=NC(=NC(=N2)N)N)[As](O)O |
| InChI | 1S/C9H11AsN6O2/c11-7-14-8(12)16-9(15-7)13-6-3-1-5(2-4-6)10(17)18/h1-4,17-18H,(H5,11,12,13,14,15,16) |
| InChIKey | LISADAZIUYLPRW-UHFFFAOYSA-N |
| Boiling point | 667.82°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 357.685°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-[(4,6-Diamino-1,3,5-Triazin-2-Yl)Amino]Phenyl]Arsonous Acid |