|
CAS#: 5429-37-8 Product: 8-Hexyl-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione No suppilers available for the product. |
| Name | 8-Hexyl-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione |
|---|---|
| Synonyms | 8-Hexyl-1,3-Dimethyl-7H-Purine-2,6-Quinone; Zinc01596688; 1H-Purine-2,6-Dione, 8-Hexyl-3,7-Dihydro-1,3-Dimethyl- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 |
| CAS Registry Number | 5429-37-8 |
| SMILES | C(C2=NC1=C(C(N(C(N1C)=O)C)=O)[NH]2)CCCCC |
| InChI | 1S/C13H20N4O2/c1-4-5-6-7-8-9-14-10-11(15-9)16(2)13(19)17(3)12(10)18/h4-8H2,1-3H3,(H,14,15) |
| InChIKey | SHZWWHZISZGGHB-UHFFFAOYSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.184°C at 760 mmHg (Cal.) |
| Flash point | 245.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Hexyl-3,7-Dihydro-1,3-Dimethyl-1H-Purine-2,6-Dione |