|
CAS#: 5429-76-5 Product: 2,6-Ditert-Butyl-4-(Thiophen-2-Ylmethyl)Phenol No suppilers available for the product. |
| Name | 2,6-Ditert-Butyl-4-(Thiophen-2-Ylmethyl)Phenol |
|---|---|
| Synonyms | 2,6-Ditert-Butyl-4-(2-Thienylmethyl)Phenol; Nsc14218 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26OS |
| Molecular Weight | 302.47 |
| CAS Registry Number | 5429-76-5 |
| SMILES | C1=C(C(C)(C)C)C(=C(C=C1CC2=CC=CS2)C(C)(C)C)O |
| InChI | 1S/C19H26OS/c1-18(2,3)15-11-13(10-14-8-7-9-21-14)12-16(17(15)20)19(4,5)6/h7-9,11-12,20H,10H2,1-6H3 |
| InChIKey | BXSAYXMPWVOTLU-UHFFFAOYSA-N |
| Density | 1.043g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.929°C at 760 mmHg (Cal.) |
| Flash point | 173.293°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Ditert-Butyl-4-(Thiophen-2-Ylmethyl)Phenol |