|
CAS#: 5430-37-5 Product: (4-Nitronaphthalen-1-Yl)Arsonic Acid No suppilers available for the product. |
| Name | (4-Nitronaphthalen-1-Yl)Arsonic Acid |
|---|---|
| Synonyms | (4-Nitro-1-Naphthyl)Arsonic Acid; Antineoplastic-13784; Nsc13784 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8AsNO5 |
| Molecular Weight | 297.10 |
| CAS Registry Number | 5430-37-5 |
| SMILES | C1=C([As](=O)(O)O)C2=C(C(=C1)[N+]([O-])=O)C=CC=C2 |
| InChI | 1S/C10H8AsNO5/c13-11(14,15)9-5-6-10(12(16)17)8-4-2-1-3-7(8)9/h1-6H,(H2,13,14,15) |
| InChIKey | XEUXBZYSGAMIPD-UHFFFAOYSA-N |
| Boiling point | 605.094°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 261.466°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Nitronaphthalen-1-Yl)Arsonic Acid |