|
CAS#: 5433-44-3 Product: 1,3-Di(4-Sulfamoylphenyl)Triazene No suppilers available for the product. |
| Name | 1,3-Di(4-Sulfamoylphenyl)Triazene |
|---|---|
| Synonyms | 4-[N'-(4-Sulfamoylphenyl)Iminohydrazino]Benzenesulfonamide; Benzenesulfonamide, 4,4'-(1-Triazene-1,3-Diyl)Bis-; 1,3-Di(4-Sulfamoylphenyl)Triazene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13N5O4S2 |
| Molecular Weight | 355.39 |
| CAS Registry Number | 5433-44-3 |
| SMILES | C1=C([S](=O)(=O)N)C=CC(=C1)NN=NC2=CC=C([S](=O)(=O)N)C=C2 |
| InChI | 1S/C12H13N5O4S2/c13-22(18,19)11-5-1-9(2-6-11)15-17-16-10-3-7-12(8-4-10)23(14,20)21/h1-8H,(H,15,16)(H2,13,18,19)(H2,14,20,21) |
| InChIKey | WKKNCBFGLHEOCW-UHFFFAOYSA-N |
| Density | 1.637g/cm3 (Cal.) |
|---|---|
| Boiling point | 613.357°C at 760 mmHg (Cal.) |
| Flash point | 324.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Di(4-Sulfamoylphenyl)Triazene |