Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 4-Chlorophenylarsonic Acid |
|---|---|
| Synonyms | Benzenearsonic Acid, P-Chloro-; Nsc15562; Wln: Q-As-Qo&R Dg |
| Molecular Structure |  |
| Molecular Formula | C6H6AsClO3 |
| Molecular Weight | 236.49 |
| CAS Registry Number | 5440-04-0 |
| EINECS | 226-622-4 |
| SMILES | C1=CC(=CC=C1[As](=O)(O)O)Cl |
| InChI | 1S/C6H6AsClO3/c8-6-3-1-5(2-4-6)7(9,10)11/h1-4H,(H2,9,10,11) |
| InChIKey | OAKWMQGNBGGJGT-UHFFFAOYSA-N |
| Boiling point | 456.774°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 230.049°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chlorophenylarsonic Acid |