|
CAS#: 5440-67-5 Product: 1-(2-Methyl-2-Nitro-Propyl)-4-Nitro-Benzene No suppilers available for the product. |
| Name | 1-(2-Methyl-2-Nitro-Propyl)-4-Nitro-Benzene |
|---|---|
| Synonyms | 1-(2-Methyl-2-Nitro-Propyl)-4-Nitro-Benzene; Nsc126456; Nsc20701 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 |
| CAS Registry Number | 5440-67-5 |
| SMILES | C1=C(CC([N+](=O)[O-])(C)C)C=CC(=C1)[N+](=O)[O-] |
| InChI | 1S/C10H12N2O4/c1-10(2,12(15)16)7-8-3-5-9(6-4-8)11(13)14/h3-6H,7H2,1-2H3 |
| InChIKey | RYQDSPKQTUQTND-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.751°C at 760 mmHg (Cal.) |
| Flash point | 180.196°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2-Methyl-2-Nitro-Propyl)-4-Nitro-Benzene |