|
CAS#: 54482-78-9 Product: 2-Deoxyglucose-1-Phosphate No suppilers available for the product. |
| Name | 2-Deoxyglucose-1-Phosphate |
|---|---|
| Synonyms | 2-Dg-1-P; 2-Deoxy-D-Arabino-Hexose 1-(Dihydrogen Phosphate); 2-Deoxyglucose-1-Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H15O8P |
| Molecular Weight | 246.15 |
| CAS Registry Number | 54482-78-9 |
| SMILES | [C@@H]([C@H](O)CO)([C@@H](CCO[P](=O)(O)O)O)O |
| InChI | 1S/C6H15O8P/c7-3-5(9)6(10)4(8)1-2-14-15(11,12)13/h4-10H,1-3H2,(H2,11,12,13)/t4-,5-,6+/m1/s1 |
| InChIKey | FYGQELPEEVKRJZ-PBXRRBTRSA-N |
| Density | 1.706g/cm3 (Cal.) |
|---|---|
| Boiling point | 605.343°C at 760 mmHg (Cal.) |
| Flash point | 319.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Deoxyglucose-1-Phosphate |