|
CAS#: 5454-47-7 Product: [4-(2,4,4-Trimethylpentan-2-Yl)Phenyl] 2-Methylpropanoate No suppilers available for the product. |
| Name | [4-(2,4,4-Trimethylpentan-2-Yl)Phenyl] 2-Methylpropanoate |
|---|---|
| Synonyms | [4-(1,1,3,3-Tetramethylbutyl)Phenyl] 2-Methylpropanoate; 2-Methylpropanoic Acid [4-(1,1,3,3-Tetramethylbutyl)Phenyl] Ester; 2-Methylpropionic Acid [4-(1,1,3,3-Tetramethylbutyl)Phenyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 |
| CAS Registry Number | 5454-47-7 |
| SMILES | C1=C(OC(C(C)C)=O)C=CC(=C1)C(C)(C)CC(C)(C)C |
| InChI | 1S/C18H28O2/c1-13(2)16(19)20-15-10-8-14(9-11-15)18(6,7)12-17(3,4)5/h8-11,13H,12H2,1-7H3 |
| InChIKey | YZICPWYLCGQURQ-UHFFFAOYSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.02°C at 760 mmHg (Cal.) |
| Flash point | 118.609°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [4-(2,4,4-Trimethylpentan-2-Yl)Phenyl] 2-Methylpropanoate |