|
CAS#: 5455-04-9 Product: N-[9-(4-Methylphenyl)Iminofluoren-2-Yl]Benzamide No suppilers available for the product. |
| Name | N-[9-(4-Methylphenyl)Iminofluoren-2-Yl]Benzamide |
|---|---|
| Synonyms | N-[9-(4-Methylphenyl)Imino-2-Fluorenyl]Benzamide; Nsc23292 |
| Molecular Structure | ![]() |
| Molecular Formula | C27H20N2O |
| Molecular Weight | 388.47 |
| CAS Registry Number | 5455-04-9 |
| SMILES | C1=CC(=CC=C1C)N=C4C2=C(C=CC(=C2)NC(=O)C3=CC=CC=C3)C5=C4C=CC=C5 |
| InChI | 1S/C27H20N2O/c1-18-11-13-20(14-12-18)28-26-24-10-6-5-9-22(24)23-16-15-21(17-25(23)26)29-27(30)19-7-3-2-4-8-19/h2-17H,1H3,(H,29,30) |
| InChIKey | XIGXZAQWWAIPHR-UHFFFAOYSA-N |
| Density | 1.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.638°C at 760 mmHg (Cal.) |
| Flash point | 266.253°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[9-(4-Methylphenyl)Iminofluoren-2-Yl]Benzamide |