|
CAS#: 5455-70-9 Product: 1-(2-Nitrophenyl)-2-Pyridin-2-Yl-Ethanol No suppilers available for the product. |
| Name | 1-(2-Nitrophenyl)-2-Pyridin-2-Yl-Ethanol |
|---|---|
| Synonyms | 1-(2-Nitrophenyl)-2-(2-Pyridyl)Ethanol; 1-(2-Nitrophenyl)-2-Pyridin-2-Yl-Ethanol; Nsc23439 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 |
| CAS Registry Number | 5455-70-9 |
| SMILES | C1=CC=CC(=C1C(CC2=NC=CC=C2)O)[N+]([O-])=O |
| InChI | 1S/C13H12N2O3/c16-13(9-10-5-3-4-8-14-10)11-6-1-2-7-12(11)15(17)18/h1-8,13,16H,9H2 |
| InChIKey | UVXFYWFBIYUTGZ-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.853°C at 760 mmHg (Cal.) |
| Flash point | 205.906°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Nitrophenyl)-2-Pyridin-2-Yl-Ethanol |