|
CAS#: 5456-14-4 Product: Diethyl 2,6-Dimethyl-4-Oxo-Pyran-3,5-Dicarboxylate No suppilers available for the product. |
| Name | Diethyl 2,6-Dimethyl-4-Oxo-Pyran-3,5-Dicarboxylate |
|---|---|
| Synonyms | Diethyl 2,6-Dimethyl-4-Oxo-Pyran-3,5-Dicarboxylate; 2,6-Dimethyl-4-Oxopyran-3,5-Dicarboxylic Acid Diethyl Ester; 4-Keto-2,6-Dimethyl-Pyran-3,5-Dicarboxylic Acid Diethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.27 |
| CAS Registry Number | 5456-14-4 |
| SMILES | C(OC(=O)C1=C(OC(=C(C1=O)C(OCC)=O)C)C)C |
| InChI | 1S/C13H16O6/c1-5-17-12(15)9-7(3)19-8(4)10(11(9)14)13(16)18-6-2/h5-6H2,1-4H3 |
| InChIKey | JISSLTOKQRHSMJ-UHFFFAOYSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.124°C at 760 mmHg (Cal.) |
| Flash point | 179.614°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 2,6-Dimethyl-4-Oxo-Pyran-3,5-Dicarboxylate |