|
CAS#: 54569-27-6 Product: 2,4-Dibromo-1,8-Naphthyridine No suppilers available for the product. |
| Name | 2,4-Dibromo-1,8-Naphthyridine |
|---|---|
| Synonyms | 2,4-Dibromo-[1,8]naphthyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4Br2N2 |
| Molecular Weight | 287.94 |
| CAS Registry Number | 54569-27-6 |
| SMILES | C1=CC2=C(N=C1)N=C(C=C2Br)Br |
| InChI | 1S/C8H4Br2N2/c9-6-4-7(10)12-8-5(6)2-1-3-11-8/h1-4H |
| InChIKey | VBFQOVZTYUFQNB-UHFFFAOYSA-N |
| Density | 2.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.0±37.0°C at 760 mmHg (Cal.) |
| Flash point | 170.9±26.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dibromo-1,8-Naphthyridine |