|
CAS#: 5457-11-4 Product: 2,2-Diphenylpropanedioic Acid No suppilers available for the product. |
| Name | 2,2-Diphenylpropanedioic Acid |
|---|---|
| Synonyms | 2,2-Di(Phenyl)Malonic Acid; Nsc21332 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 |
| CAS Registry Number | 5457-11-4 |
| SMILES | C1=CC=CC=C1C(C(=O)O)(C(O)=O)C2=CC=CC=C2 |
| InChI | 1S/C15H12O4/c16-13(17)15(14(18)19,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,16,17)(H,18,19) |
| InChIKey | YJGUVTBNQCVSQB-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.462°C at 760 mmHg (Cal.) |
| Flash point | 223.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Diphenylpropanedioic Acid |