|
CAS#: 54593-32-7 Product: (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-Piperidin-2-Yl]Acetic Acid No suppilers available for the product. |
| Name | (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-Piperidin-2-Yl]Acetic Acid |
|---|---|
| Synonyms | (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-2-Piperidyl]Acetic Acid; (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-2-Piperidinyl]Acetic Acid; (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-Piperidin-2-Yl]Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 |
| CAS Registry Number | 54593-32-7 |
| SMILES | [C@@H](C1=CC=C(O)C=C1)([C@@H]2NCCCC2)C(=O)O |
| InChI | 1S/C13H17NO3/c15-10-6-4-9(5-7-10)12(13(16)17)11-3-1-2-8-14-11/h4-7,11-12,14-15H,1-3,8H2,(H,16,17)/t11-,12-/m1/s1 |
| InChIKey | RONUHFNRYTWMCI-VXGBXAGGSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.085°C at 760 mmHg (Cal.) |
| Flash point | 211.489°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-Piperidin-2-Yl]Acetic Acid |