|
CAS#: 5461-77-8 Product: 2,3-Dichlorobenzothiophene 1,1-Dioxide No suppilers available for the product. |
| Name | 2,3-Dichlorobenzothiophene 1,1-Dioxide |
|---|---|
| Synonyms | 2,3-Dichlorobenzothiophene 1,1-Dioxide; Nsc25055; 2,3-Dichlorobenzo[B]Thiophene, 1,1-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4Cl2O2S |
| Molecular Weight | 235.08 |
| CAS Registry Number | 5461-77-8 |
| SMILES | C1=CC=CC2=C1[S](=O)(=O)C(=C2Cl)Cl |
| InChI | 1S/C8H4Cl2O2S/c9-7-5-3-1-2-4-6(5)13(11,12)8(7)10/h1-4H |
| InChIKey | BMWLALPJBZFJIO-UHFFFAOYSA-N |
| Density | 1.682g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.98°C at 760 mmHg (Cal.) |
| Flash point | 195.701°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dichlorobenzothiophene 1,1-Dioxide |