|
CAS#: 54649-24-0 Product: Potassium Hexyl Sulphate No suppilers available for the product. |
| Name | Potassium Hexyl Sulphate |
|---|---|
| Synonyms | Potassium Hexyl Sulphate; Sulfuric Acid, Monohexyl Ester, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13KO4S |
| Molecular Weight | 220.32 |
| CAS Registry Number | 54649-24-0 |
| EINECS | 259-276-8 |
| SMILES | C(O[S]([O-])(=O)=O)CCCCC.[K+] |
| InChI | 1S/C6H14O4S.K/c1-2-3-4-5-6-10-11(7,8)9;/h2-6H2,1H3,(H,7,8,9);/q;+1/p-1 |
| InChIKey | AJKHLYLYOXLEEN-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Potassium Hexyl Sulphate |